3,4-Dihexylthiophene manufacturers
- 3,4-Dihexylthiophene
-
- $1.10 / 1g
-
2025-11-18
- CAS:122107-04-4
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | 3,4-Dihexylthiophene Basic information |
| Product Name: | 3,4-Dihexylthiophene | | Synonyms: | 3,4-Dihexylthiophene;3,4-Bis-n-hexyl thiophene;Thiophene, 3,4-dihexyl-;3,4-Dihexylthiophene>3,4-Dihexylthiophene ISO 9001:2015 REACH | | CAS: | 122107-04-4 | | MF: | C16H28S | | MW: | 252.46 | | EINECS: | | | Product Categories: | | | Mol File: | 122107-04-4.mol |  |
| | 3,4-Dihexylthiophene Chemical Properties |
| Boiling point | 103°C/0.3mmHg(lit.) | | density | 0.925 g/mL at 25 °C | | refractive index | n20/D1.494 | | Fp | >110℃ | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C16H28S/c1-3-5-7-9-11-15-13-17-14-16(15)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3 | | InChIKey | YIRIIAIZQBBXHL-UHFFFAOYSA-N | | SMILES | C1SC=C(CCCCCC)C=1CCCCCC |
| WGK Germany | 3 | | HS Code | 2934.99.4400 | | Storage Class | 10 - Combustible liquids |
| | 3,4-Dihexylthiophene Usage And Synthesis |
| Uses | This material is used in the synthesis of donor-acceptor copolymers and low-band gap polymers for use in Organic Photovoltaic Applications. It also has shown to enhance the thermal stability of polythiophene: fullerene solar cells. |
| | 3,4-Dihexylthiophene Preparation Products And Raw materials |
|