|
|
| | 3-(Trifluoromethoxy)bromobenzene Basic information |
| | 3-(Trifluoromethoxy)bromobenzene Chemical Properties |
| Boiling point | 156-158 °C | | density | 1.62 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | 145 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.64 | | BRN | 1945938 | | InChI | InChI=1S/C7H4BrF3O/c8-5-2-1-3-6(4-5)12-7(9,10)11/h1-4H | | InChIKey | WVUDHWBCPSXAFN-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(OC(F)(F)F)=C1 | | CAS DataBase Reference | 2252-44-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3-(Trifluoromethoxy)bromobenzene(2252-44-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29049090 | | Storage Class | 10 - Combustible liquids |
| | 3-(Trifluoromethoxy)bromobenzene Usage And Synthesis |
| Chemical Properties | Clear very faintly yellow liquid | | Uses | 1-Bromo-3-(trifluoromethoxy)benzene may be used in the preparation of 1,2-dehydro-3-(trifluoromethoxy)benzene. It may be used in the synthesis of new electronically deficient atropisomeric diphosphine ligand (S)-CF3O-BiPhep [2,2′-bis(diphenylphosphino)-6,6′-ditrifluoromethoxy-1,1′-biphenyl]. | | General Description | 1-Bromo-3-(trifluoromethoxy)benzene undergoes Diels-Alder reaction with lithium diisopropylamide (LDA) in THF and furan, to yield the corresponding 1,4-dihydro-1,4-epoxy-5- or 6-(trifluoromethoxy)naphthalenes. | | Synthesis | The general procedure for the synthesis of 3-trifluoromethoxybromobenzene from p-trifluoromethoxyaniline is described below:
Example 5 (comparative experiment) Preparation of 1-bromo-3-trifluoromethoxybenzene using bromine (Br2) in acetic acid medium. This was done as follows: 60 g of acetic acid was added to a 100 mL round bottom flask, followed by the slow addition of 30 g of 4-trifluoromethoxyaniline. After cooling the reaction mixture to 0-5 °C, 27 g of bromine was slowly added dropwise. Upon completion of the reaction, the reaction mixture was analyzed by gas chromatography, which showed 20% unreacted 4-trifluoromethoxyaniline, 37% monobrominated derivatives and more than 41% dibrominated derivatives. | | References | [1] Patent: WO2007/107820, 2007, A2. Location in patent: Page/Page column 9 |
| | 3-(Trifluoromethoxy)bromobenzene Preparation Products And Raw materials |
|