| Company Name: |
Hyper, Inc. Gold |
| Tel: |
18966379725 |
| Email: |
1028592743@qq.com |
|
| | 3-undecylthieno[3,2-b]thiophene Basic information |
| Product Name: | 3-undecylthieno[3,2-b]thiophene | | Synonyms: | 3-undecylthieno[3,2-b]thiophene;IN1839, 3-undecylthieno[3,2-b]thiophene;Thieno[3,2-b]thiophene, 3-undecyl-;EA587;TT11;6-undecylthieno[3,2-b]thiophene | | CAS: | 950223-97-9 | | MF: | C17H26S2 | | MW: | 294.52 | | EINECS: | | | Product Categories: | | | Mol File: | 950223-97-9.mol | ![3-undecylthieno[3,2-b]thiophene Structure](CAS/20150408/GIF/950223-97-9.gif) |
| | 3-undecylthieno[3,2-b]thiophene Chemical Properties |
| Boiling point | 394.7±22.0 °C(Predicted) | | density | 1.037±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C17H26S2/c1-2-3-4-5-6-7-8-9-10-11-15-14-19-16-12-13-18-17(15)16/h12-14H,2-11H2,1H3 | | InChIKey | BVCVLQZKDYRAHL-UHFFFAOYSA-N | | SMILES | C12C=CSC=1C(CCCCCCCCCCC)=CS2 |
| | 3-undecylthieno[3,2-b]thiophene Usage And Synthesis |
| Uses | 3-Undecyl-thieno[3,2-b]thiophene is a fused benzothiadiazole, which is used as a building block for n-type organic acceptor to achieve high-performance organic solar cells. |
| | 3-undecylthieno[3,2-b]thiophene Preparation Products And Raw materials |
|