|
|
| | 1-METHYL-PIPERIDINE-4-CARBONITRILE Basic information |
| Product Name: | 1-METHYL-PIPERIDINE-4-CARBONITRILE | | Synonyms: | 1-METHYL-PIPERIDINE-4-CARBONITRILE;1-Methyl-piperidine-4-carbonitrile ,97%;4-Cyano-1-methyl-piperidine;1-Methyl-4-cyanopiperidine;1-Methyl-4-piperidinecarbonitrile;1-Methylisonipecotonitrile;4-Piperidinecarbonitrile, 1-methyl- | | CAS: | 20691-92-3 | | MF: | C7H12N2 | | MW: | 124.18 | | EINECS: | | | Product Categories: | | | Mol File: | 20691-92-3.mol |  |
| | 1-METHYL-PIPERIDINE-4-CARBONITRILE Chemical Properties |
| Melting point | 44-46° | | Boiling point | 85-88℃ (14 Torr) | | refractive index | 1.4615 (20℃) | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H12N2/c1-9-4-2-7(6-8)3-5-9/h7H,2-5H2,1H3 | | InChIKey | HNAKTMSXYZOSTP-UHFFFAOYSA-N | | SMILES | N1(C)CCC(C#N)CC1 |
| Risk Statements | 23/24/25-33 | | Safety Statements | 28-37-45 | | RIDADR | 3276 | | HazardClass | 6.1 | | HS Code | 29333990 |
| | 1-METHYL-PIPERIDINE-4-CARBONITRILE Usage And Synthesis |
| Chemical Properties | Colourless liquid | | Uses |
1-Methyl-piperidine-4-carbonitrile can be used in medicine and organic synthesis.
|
| | 1-METHYL-PIPERIDINE-4-CARBONITRILE Preparation Products And Raw materials |
|