| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one Basic information |
| Product Name: | 6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one | | Synonyms: | 6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one;6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one - B8420;1-Oxa-6-azaspiro[3.3]heptane-6-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester;6-Boc-3-oxo-1-oxa-6-azaspiro[3.3]heptane;1,1-Dimethylethyl 3-oxo-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate | | CAS: | 1349199-61-6 | | MF: | C10H15NO4 | | MW: | 213.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1349199-61-6.mol | ![6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one Structure](CAS/GIF/1349199-61-6.gif) |
| | 6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one Chemical Properties |
| Boiling point | 331.0±42.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | -1.19±0.20(Predicted) | | Appearance | Colorless to light yellow Viscous liquid | | InChI | 1S/C10H15NO4/c1-9(2,3)15-8(13)11-5-10(6-11)7(12)4-14-10/h4-6H2,1-3H3 | | InChIKey | OIFFGPWHSKSMTM-UHFFFAOYSA-N | | SMILES | O=C1C2(CN(C(OC(C)(C)C)=O)C2)OC1 |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one Usage And Synthesis |
| Uses | Spirocyclic building block is part of a series of advanced angular[3.3]heptanes developed by Carreira and coworkers. |
| | 6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-one Preparation Products And Raw materials |
|