- 2,4-DIMETHYLTHIOPHENE
-
- $0.00 / 25kg
-
2025-12-01
- CAS:638-00-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 2,4-DIMETHYLTHIOPHENE
-
- $1.10 / 1g
-
2025-11-18
- CAS:638-00-6
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- 2,4-DIMETHYLTHIOPHENE
-
- $1.00 / 1KG
-
2019-07-06
- CAS:638-00-6
- Min. Order: 1G
- Purity: 98%
- Supply Ability: 100KG
|
| | 2,4-DIMETHYLTHIOPHENE Basic information |
| Product Name: | 2,4-DIMETHYLTHIOPHENE | | Synonyms: | Thiophene, 2,4-dimethyl-;2,4-DIMETHYLTHIOPHENE;2,4-Dimethylthiophene, 95%, for synthesis;2,4-DIMETHYLTHIOPHENE ISO 9001:2015 REACH;2,4-dimethylthiophene CAS NO.638-00-6;2,4-Dimethylthiophene in isooctane | | CAS: | 638-00-6 | | MF: | C6H8S | | MW: | 112.19 | | EINECS: | 211-312-3 | | Product Categories: | | | Mol File: | 638-00-6.mol |  |
| | 2,4-DIMETHYLTHIOPHENE Chemical Properties |
| Melting point | -66.9°C (estimate) | | Boiling point | 139-141°C | | density | 0,994 g/cm3 | | refractive index | 1.5078 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | liquid (estimate) | | Appearance | Colorless to light yellow Liquid | | Henry's Law Constant | 1.5×10-3 mol/(m3Pa) at 25℃, Yaws et al. (2003) | | InChI | InChI=1S/C6H8S/c1-5-3-6(2)7-4-5/h3-4H,1-2H3 | | InChIKey | CPULIKNSOUFMPL-UHFFFAOYSA-N | | SMILES | C1(C)SC=C(C)C=1 | | LogP | 2.595 (est) | | CAS DataBase Reference | 638-00-6(CAS DataBase Reference) |
| | 2,4-DIMETHYLTHIOPHENE Usage And Synthesis |
| Uses | 2,4-Dimethylthiophene is a biochemical used for proteomics and food research. |
| | 2,4-DIMETHYLTHIOPHENE Preparation Products And Raw materials |
|