| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 6,6-Difluoro-spiro[3.3]heptane-2-carboxylic acid Basic information |
| | 6,6-Difluoro-spiro[3.3]heptane-2-carboxylic acid Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C8H10F2O2/c9-8(10)3-7(4-8)1-5(2-7)6(11)12/h5H,1-4H2,(H,11,12) | | InChIKey | XRVCRDQMFKNZJR-UHFFFAOYSA-N | | SMILES | FC1(F)CC2(C1)CC(C(O)=O)C2 |
| HS Code | 2916200090 | | Storage Class | 11 - Combustible Solids |
| | 6,6-Difluoro-spiro[3.3]heptane-2-carboxylic acid Usage And Synthesis |
| | 6,6-Difluoro-spiro[3.3]heptane-2-carboxylic acid Preparation Products And Raw materials |
|