- Ac-Gly-Oet
-
-
2026-06-12
- CAS:1906-82-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | Ethyl acetamidoacetate Basic information |
| | Ethyl acetamidoacetate Chemical Properties |
| Melting point | 43-46 °C(lit.) | | Boiling point | 260 °C712 mm Hg(lit.) | | density | 1.2511 (rough estimate) | | refractive index | 1.4300 (estimate) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder to lump | | pka | 14.75±0.46(Predicted) | | color | White to Almost white | | Major Application | peptide synthesis | | InChI | InChI=1S/C6H11NO3/c1-3-10-6(9)4-7-5(2)8/h3-4H2,1-2H3,(H,7,8) | | InChIKey | AMBDTBHJFINMSE-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CNC(C)=O | | CAS DataBase Reference | 1906-82-7(CAS DataBase Reference) | | NIST Chemistry Reference | Glycine, N-acetyl-, ethyl ester(1906-82-7) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29241990 | | Storage Class | 11 - Combustible Solids |
| | Ethyl acetamidoacetate Usage And Synthesis |
| Chemical Properties | white shiny crystalline powder | | Uses | Ethyl Acetamidoacetate is used in biological studies as pre-fermentative replacement of SO2 by lysozyme and oenological tannins effects on flavor volatiles during the bottled storage of white wines. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Ethyl acetamidoacetate Preparation Products And Raw materials |
|