|
|
| | LincoMycin 2-Phosphate Basic information |
| Product Name: | LincoMycin 2-Phosphate | | Synonyms: | Clindamycin Impurity 15(Clindamycin Phosphate EP Impurity F);Lincomycin 2-Phosphate, Clindamycin phosphate Impurity F;methyl 6,8-dideoxy-6-[[[(2S,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-D-erythro-α-D-galacto-Octopyranoside 2-(dihydrogen phosphate);Clindamycin Phosphate EP Impurity F;Clindamycin Impurity G;(2R,3R,4S,5R,6R)-4,5-dihydroxy;Clindamycin phosphate Impurity F(Lincomycin 2-Phosphate);Clindamycin EP Impurity F | | CAS: | 27480-30-4 | | MF: | C18H35N2O9PS | | MW: | 486.52 | | EINECS: | | | Product Categories: | | | Mol File: | 27480-30-4.mol |  |
| | LincoMycin 2-Phosphate Chemical Properties |
| Melting point | >208°C (dec.) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly, Heated), Water (Slightly) | | form | Solid | | pka | 1.83±0.10(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | NVNQOUOFMWKNLY-UHFFFAOYSA-N | | SMILES | C(C1C(C(O)C(OP(O)(O)=O)C(SC)O1)O)(C(O)C)NC(C1N(CC(CCC)C1)C)=O |
| | LincoMycin 2-Phosphate Usage And Synthesis |
| Description | Lincomycin 2-Phosphate is the derivative of Lincomycin, a lincosamide antibiotic that forms cross-links within the peptidyl transferase loop region of 23S rRNA. Lincomycin 2-Phosphate is also known as Clindamycin Phosphate EP Impurity F, methyl 6,8-dideoxy-6-[[[(2S,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-D-erythro-α-D-galacto-Octopyranoside 2-(dihydrogen phosphate), and methyl 6,8-dideoxy-6-[[[(2S,4R)-1-methyl-4-propylpyrrolidin-2-yl]carbonyl]amino]-2-O-phosphono-1-thio-D-erythro-α-D-galacto-octopyranoside. | | Chemical Properties | Lincomycin 2-Phosphate (Clindamycin Phosphate EP Impurity F) is the derivative of Lincomycin (L466200), a lincosamide antibiotic that forms cross-links within the peptidyl transferase loop region of the 23S rRNA. Inhibits bacterial protein synthesis. | | Uses | Lincomycin 2-Phosphate (Clindamycin Phosphate EP Impurity F) is the derivative of Lincomycin (L466200), a lincosamide antibiotic that forms cross-links within the peptidyl transferase loop region of the 23S rRNA. Inhibits bacterial protein synthesis. Antibacterial. |
| | LincoMycin 2-Phosphate Preparation Products And Raw materials |
|