|
|
| | (6S)-5,6,7,8-Tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-1-naphthalenol Basic information |
| Product Name: | (6S)-5,6,7,8-Tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-1-naphthalenol | | Synonyms: | (6S)-5,6,7,8-Tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-1-naphthalenol;Rotigotine USP RC C;Rotigotine Impurity 3(Rotigotine USP RC C);Rotigotine USP Related Compound C;(6S)-6-{[2-(2-Thienyl)ethyl]amino}-5,6,7,8-tetrahydro-1-naphthalenol;Despropylrotigotine ((6S)-5,6,7,8-T;Depropyl Rotigotine HCl;1-Naphthalenol, 5,6,7,8-tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-, (6S)- | | CAS: | 153409-14-4 | | MF: | C16H19NOS | | MW: | 273.39 | | EINECS: | | | Product Categories: | | | Mol File: | 153409-14-4.mol | ![(6S)-5,6,7,8-Tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-1-naphthalenol Structure](CAS/20150408/GIF/153409-14-4.gif) |
| | (6S)-5,6,7,8-Tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-1-naphthalenol Chemical Properties |
| Boiling point | 446.8±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 10.49±0.40(Predicted) | | Major Application | pharmaceutical | | InChI | 1S/C16H19NOS/c18-16-5-1-3-12-11-13(6-7-15(12)16)17-9-8-14-4-2-10-19-14/h1-5,10,13,17-18H,6-9,11H2/t13-/m0/s1 | | InChIKey | RDMWWGLKUMLLTG-ZDUSSCGKSA-N | | SMILES | [s]1c(ccc1)CCN[C@H]2CCc3c(cccc3O)C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (6S)-5,6,7,8-Tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-1-naphthalenol Usage And Synthesis |
| Uses | Despropylrotigotine can be obtained from 5-Methoxy-2-tetralone (M268705) which is an intermediate in the production of Rotigotine. |
| | (6S)-5,6,7,8-Tetrahydro-6-[[2-(2-thienyl)ethyl]amino]-1-naphthalenol Preparation Products And Raw materials |
|