2,2-difluoro-2-triphenylphosphaniumylacetate manufacturers
|
| | 2,2-difluoro-2-triphenylphosphaniumylacetate Basic information |
| Product Name: | 2,2-difluoro-2-triphenylphosphaniumylacetate | | Synonyms: | (Triphenylphosphonio)difluoroacetate;2,2-difluoro-2-triphenylphosphaniumylacetate;Difluoro(triphenylphosphonio)acetate;Difluoro(triphenylphosphonic)acetate;2,2-Difluoro-2-(triphenylphosphonio)acetate;PDFA;Phosphonium, (carboxydifluoromethyl)triphenyl-, inner salt;(carboxydifluoromethyl)triphenyl-Phosphonium inner salt | | CAS: | 1449521-05-4 | | MF: | C20H15F2O2P | | MW: | 356.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1449521-05-4.mol |  |
| | 2,2-difluoro-2-triphenylphosphaniumylacetate Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C20H15F2O2P/c21-20(22,19(23)24)25(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H | | InChIKey | STIBMNDFQNRAQX-UHFFFAOYSA-N | | SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)C(F)(F)C(=O)[O-] |
| | 2,2-difluoro-2-triphenylphosphaniumylacetate Usage And Synthesis |
| Uses | 2,2-Difluoro-2-triphenylphosphinoacetate is mainly used as a catalyst in organic synthesis, especially in the synthesis of cyclic esters. |
| | 2,2-difluoro-2-triphenylphosphaniumylacetate Preparation Products And Raw materials |
|