| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | 5-(difluoromethyl)thiophene-2-carboxylic acid Basic information |
| | 5-(difluoromethyl)thiophene-2-carboxylic acid Chemical Properties |
| Boiling point | 298.6±40.0 °C(Predicted) | | density | 1.492±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.19±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4F2O2S/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2,5H,(H,9,10) | | InChIKey | XITCEGGANINIMZ-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC(C(F)F)=CC=1 |
| | 5-(difluoromethyl)thiophene-2-carboxylic acid Usage And Synthesis |
| | 5-(difluoromethyl)thiophene-2-carboxylic acid Preparation Products And Raw materials |
|