|
|
| | 23-Hydroxytormentic acid Basic information |
| Product Name: | 23-Hydroxytormentic acid | | Synonyms: | 23-Hydroxytormentic acid;19α-Hydroxyasiatic acid（2α,19,23-Trihydroxyursolic acid）;Urs-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, (2α,3β,4α)-;23-Hydroxytormentic acid >=95% (LC/MS-ELSD);19α-Hydroxyasiatic acid | | CAS: | 70868-78-9 | | MF: | C30H48O6 | | MW: | 504.71 | | EINECS: | | | Product Categories: | | | Mol File: | 70868-78-9.mol |  |
| | 23-Hydroxytormentic acid Chemical Properties |
| Melting point | 282-284 °C | | Boiling point | 639.3±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | Solid | | pka | 4.46±0.70(Predicted) | | color | White to off-white | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | YCOKATFNRPZIIU-NIZSJLHKSA-N | | SMILES | C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@@]34C)[C@@H]2[C@]1(C)O)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 23-Hydroxytormentic acid Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: 19alpha-hydroxyasiatic acid is a pentacyclic triterpenoid that is asiatic acid substituted by a hydroxy group at position 19. It has been isolated from the leaves of Rosa laevigata. It has a role as an anti-inflammatory agent and a plant metabolite. It is a pentacyclic triterpenoid, a hydroxy monocarboxylic acid and a tetrol. It is functionally related to an asiatic acid. It derives from a hydride of an ursane. |
| | 23-Hydroxytormentic acid Preparation Products And Raw materials |
|