| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
K201 hemifumarate manufacturers
|
| | K201 hemifumarate Basic information |
| Product Name: | K201 hemifumarate | | Synonyms: | 1-(2,3-Dihydro-7-methoxy-1,4-benzothiazepin-4(5H)-yl)-3-[4-(phenylmethyl)-1-piperidinyl]-1-propanone hemifumarate;JTV-519 hemifumarate;K201 hemifumarate;1-(2,3-Dihydro-7-methoxy-1,4-benzothiazepin-4(5H)-yl)-3-[4-(phenylmethyl)-1-piperidinyl]-1-propanone;4-[3-(4-Benzylpiperidin-1-yl)propionyl]-7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine;3-(4-benzylpiperidin-1-yl)-1-(7-methoxy-2,3-dihydrobenzo[f][1,4]thiazepin-4(5H)-yl)propan-1-one(K201 hemifumarate);JTV-519
(K201;JTV-519 free base | | CAS: | 145903-06-6 | | MF: | C25H32N2O2S | | MW: | 424.6 | | EINECS: | | | Product Categories: | | | Mol File: | 145903-06-6.mol |  |
| | K201 hemifumarate Chemical Properties |
| Boiling point | 615.1±55.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble10mg/mL, clear | | form | powder | | pka | 8.93±0.10(Predicted) | | color | white to beige | | BRN | 10598851 | | InChIKey | MNAIJOCDPCXVEY-WXXKFALUSA-N | | SMILES | OC(=O)\C=C\C(O)=O.COc1ccc2SCCN(Cc2c1)C(=O)CCN3CCC(CC3)Cc4ccccc4.COc5ccc6SCCN(Cc6c5)C(=O)CCN7CCC(CC7)Cc8ccccc8 |
| Hazard Codes | N,Xn | | Risk Statements | 50/53-53-22 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | K201 hemifumarate Usage And Synthesis |
| Biochem/physiol Actions | JTV-519 is a potent inhibitor or the ryanodine receptor 2 (RYR2) blocker. RYR2 is a cardiac calcium channel that regulates calcium levels in the sarcoplasmic reticulum. JTV-519 stabilizes RYR2 in the closed state. |
| | K201 hemifumarate Preparation Products And Raw materials |
|