|
|
| | MIDA anhydride Basic information |
| Product Name: | MIDA anhydride | | Synonyms: | MIDA anhydride;4-Methylmorpholine-2,6-dione 97%;4-methyl-2,6-Morpholinedione;(N-methylimino)diacetic acid anhydride;2,6-Morpholinedione, 4-methyl-;4-Methylmorpholine-2,6-dione | | CAS: | 13480-36-9 | | MF: | C5H7NO3 | | MW: | 129.11 | | EINECS: | | | Product Categories: | | | Mol File: | 13480-36-9.mol |  |
| | MIDA anhydride Chemical Properties |
| Melting point | 41-45°C | | Boiling point | 252.5±33.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | -20°C, stored under nitrogen | | pka | 3.35±0.20(Predicted) | | form | solid | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C5H7NO3/c1-6-2-4(7)9-5(8)3-6/h2-3H2,1H3 | | InChIKey | FGQJBZHMORPBRR-UHFFFAOYSA-N | | SMILES | N1(C)CC(=O)OC(=O)C1 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | MIDA anhydride Usage And Synthesis |
| | MIDA anhydride Preparation Products And Raw materials |
|