| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2-[1-(3-Fluorophenyl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 2-[1-(3-Fluorophenyl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | 1-(3-Fluorophenyl)vinylboronic acid pinacol ester;2-[1-(3-Fluorophenyl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(1-(3-fluorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3-dioxa-2-borolane;1-(3-Fluorophenyl)vinylboronic acid pinacol ester 97%;1,3,2-Dioxaborolane, 2-[1-(3-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl- | | CAS: | 1239700-55-0 | | MF: | C14H18BFO2 | | MW: | 248.1 | | EINECS: | | | Product Categories: | | | Mol File: | 1239700-55-0.mol | ![2-[1-(3-Fluorophenyl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Structure](CAS/20180703/GIF/1239700-55-0.gif) |
| | 2-[1-(3-Fluorophenyl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 277.8±42.0 °C(Predicted) | | density | 1.041 g/mL at 25 °C | | refractive index | n20/D1.499 | | Fp | >100℃ | | storage temp. | 2-8°C | | form | liquid | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C14H18BFO2/c1-10(11-7-6-8-12(16)9-11)15-17-13(2,3)14(4,5)18-15/h6-9H,1H2,2-5H3 | | InChIKey | JHYKXYAWAWZTCM-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C(C1=CC=CC(F)=C1)=C |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2-[1-(3-Fluorophenyl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| | 2-[1-(3-Fluorophenyl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|