| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Butyl-1-methylpiperidinium hexafluorophosphate
Basic information |
| | 1-Butyl-1-methylpiperidinium hexafluorophosphate
Chemical Properties |
| form | crystals | | InChI | 1S/C10H22N.F6P/c1-3-4-8-11(2)9-6-5-7-10-11;1-7(2,3,4,5)6/h3-10H2,1-2H3;/q+1;-1 | | InChIKey | FHOLSPXOTQMKMZ-UHFFFAOYSA-N | | SMILES | F[P-](F)(F)(F)(F)F.CCCC[N+]1(C)CCCCC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-Butyl-1-methylpiperidinium hexafluorophosphate
Usage And Synthesis |
| Uses | 1-Butyl-1-methylpiperidinium hexafluorophosphate (BMPIPPF6) is an ionic liquid that can be used to prepare modified carbon composite electrodes, which are used as sensors in the estimation of paracetamol, neurotransmitter drugs and NADH in the biological samples.
|
| | 1-Butyl-1-methylpiperidinium hexafluorophosphate
Preparation Products And Raw materials |
|