| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-Oxa-5-azaspiro[3.4]octane oxalate salt Basic information |
| | 2-Oxa-5-azaspiro[3.4]octane oxalate salt Chemical Properties |
| Melting point | 85-94°C | | storage temp. | -20°C | | form | solid | | InChI | 1S/C6H11NO.C2H2O4/c1-2-6(7-3-1)4-8-5-6;3-1(4)2(5)6/h7H,1-5H2;(H,3,4)(H,5,6) | | InChIKey | JFOZNINEJYPQQK-UHFFFAOYSA-N | | SMILES | OC(C(O)=O)=O.C1CCNC12COC2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Oxa-5-azaspiro[3.4]octane oxalate salt Usage And Synthesis |
| | 2-Oxa-5-azaspiro[3.4]octane oxalate salt Preparation Products And Raw materials |
|