| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(3-Chloro-4-fluorophenyl)biguanide hydrochloride Basic information |
| | 1-(3-Chloro-4-fluorophenyl)biguanide hydrochloride Chemical Properties |
| Melting point | 209-213 °C (lit.) | | form | crystalline powder | | color | Light grey to faint purple | | InChI | 1S/C8H9ClFN5.ClH/c9-5-3-4(1-2-6(5)10)14-8(13)15-7(11)12;/h1-3H,(H6,11,12,13,14,15);1H | | InChIKey | DLLQSZUCBVOQDX-UHFFFAOYSA-N | | SMILES | Cl.NC(=N)NC(=N)Nc1ccc(F)c(Cl)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2925290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(3-Chloro-4-fluorophenyl)biguanide hydrochloride Usage And Synthesis |
| | 1-(3-Chloro-4-fluorophenyl)biguanide hydrochloride Preparation Products And Raw materials |
|