|
|
| | 2,2'-Azodi(2-methylbutyronitrile) Basic information | | Uses |
| | 2,2'-Azodi(2-methylbutyronitrile) Chemical Properties |
| Melting point | 49-52 °C | | Boiling point | 318.25°C (rough estimate) | | density | 1.1 | | vapor pressure | 0.354Pa at 25℃ | | refractive index | 1.4910 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | 392mg/L at 20℃ | | Stability: | Explosive. Risk of explosion if struck, ground or heated. Highly flammable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C10H16N4/c1-5-9(3,7-11)13-14-10(4,6-2)8-12/h5-6H2,1-4H3 | | InChIKey | AVTLBBWTUPQRAY-UHFFFAOYSA-N | | SMILES | N(C(C)(CC)C#N)=NC(C)(CC)C#N | | LogP | 2.07 at 20℃ | | CAS DataBase Reference | 13472-08-7(CAS DataBase Reference) | | EPA Substance Registry System | 2,2'-Azobis[2-methylbutanenitrile] (13472-08-7) |
| Hazard Codes | F,Xn | | Risk Statements | 11-22-2017/11/22 | | Safety Statements | 47-36/37/39-24/25-16 | | RIDADR | UN 3236 4.1 | | WGK Germany | 1 | | RTECS | EK4818750 | | F | 4.4 | | TSCA | TSCA listed | | HazardClass | 4.1 | | PackingGroup | II | | HS Code | 29270000 | | Toxicity | LD50 orl-rat: 982 mg/kg NTIS** OTS0540633 |
| | 2,2'-Azodi(2-methylbutyronitrile) Usage And Synthesis |
| Uses | 2,2'-Azodi(2-methylbutyronitrile) is used in biochemical reagents, polymer initiators, surfactants, etc. | | Chemical Properties | solid | | Hazard | Moderately toxic by ingestion. | | Flammability and Explosibility | Not classified | | Safety Profile | Moderately toxic by ingestion.When heated to decomposition it emits toxic vapors ofNOx. |
| | 2,2'-Azodi(2-methylbutyronitrile) Preparation Products And Raw materials |
|