|
|
| | N,O-Dibenzylated formoterol Basic information |
| Product Name: | N,O-Dibenzylated formoterol | | Synonyms: | (N,O-Dibenzylated)FormoterolFumarate(ForFormoterolFumarate);n,o-dibenzylated formoterol;N,O-DIBENZYLATED FORMOTEROL FUMARATE;n-[5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl](phenylmethyl)amino]ethyl]-2-(phenylmethoxy)phenyl]-formamide;(N,O-DIBENZYLATED) FORMOTEROL FUMARATE, 98% ( FOR FORMOTEROL FUMARATE );Arformoterol Impurity 28;N,O dibenzyl formoterol base;Benzyl forMoterol base pairs | | CAS: | 43229-70-5 | | MF: | C33H36N2O4 | | MW: | 524.65 | | EINECS: | | | Product Categories: | | | Mol File: | 43229-70-5.mol |  |
| | N,O-Dibenzylated formoterol Chemical Properties |
| Boiling point | 724.1±60.0 °C(Predicted) | | density | 1.189 | | solubility | Soluble in methanol, acetic acid. Sparingly soluble in ethyl acetate, Insoluble in water | | pka | 13.74±0.20(Predicted) | | form | Brown Syrup | | color | White to off white crystalline powder | | InChIKey | RVGUTXYKHMDBPX-UHFFFAOYSA-N | | SMILES | C(NC1=CC(C(O)CN(C(C)CC2=CC=C(OC)C=C2)CC2=CC=CC=C2)=CC=C1OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 43229-70-5(CAS DataBase Reference) |
| | N,O-Dibenzylated formoterol Usage And Synthesis |
| Uses | N-(5-(2-(Benzyl(1-(4-methoxyphenyl)propan-2-yl)amino)-1-hydroxyethyl)-2-(benzyloxy)phenyl)formamide is an intermediate in the synthesis of Formoterol Fumarate (F693401). |
| | N,O-Dibenzylated formoterol Preparation Products And Raw materials |
|