|
|
| | 4-Amino-2-(trifluoromethyl)benzonitrile Basic information |
| | 4-Amino-2-(trifluoromethyl)benzonitrile Chemical Properties |
| Melting point | 141-145 °C(lit.) | | Boiling point | 294.5±40.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | pka | 0.50±0.10(Predicted) | | form | Powder | | color | White to off-white | | BRN | 3278074 | | InChI | InChI=1S/C8H5F3N2/c9-8(10,11)7-3-6(13)2-1-5(7)4-12/h1-3H,13H2 | | InChIKey | PMDYLCUKSLBUHO-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(N)C=C1C(F)(F)F | | CAS DataBase Reference | 654-70-6(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Amino-2-cyanobenzotrifluoride(654-70-6) |
| Hazard Codes | Xn,T | | Risk Statements | 22-43-36/37/38-20/21/22 | | Safety Statements | 36-45-37/39-26 | | RIDADR | 3439 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 4-Amino-2-(trifluoromethyl)benzonitrile Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 4-Amino-2-(trifluoromethyl)benzonitrile is used for the preparation of benzene derivatives as non-steroidal androgen receptor modulators. | | Uses | 4-Amino-2-(trifluoromethyl)benzonitrile can serve as starting material in the synthesis of benzimidazoles, which can act as potential candidates in the treatment of breast cancer due to their ability to inhibit the growth of endothelial cells. |
| | 4-Amino-2-(trifluoromethyl)benzonitrile Preparation Products And Raw materials |
|