|
|
| | 4-(4'-FLUOROPHENOXY)BENZALDEHYDE Basic information |
| | 4-(4'-FLUOROPHENOXY)BENZALDEHYDE Chemical Properties |
| Melting point | 76-80 °C | | Boiling point | 317.6±27.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | InChI=1S/C13H9FO2/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12/h1-9H | | InChIKey | YUPBWHURNLRZQL-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(OC2=CC=C(F)C=C2)C=C1 | | CAS DataBase Reference | 137736-06-2(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 22-41-51/53 | | Safety Statements | 26-36/39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-(4'-FLUOROPHENOXY)BENZALDEHYDE Usage And Synthesis |
| | 4-(4'-FLUOROPHENOXY)BENZALDEHYDE Preparation Products And Raw materials |
|