|
|
| | (R)-1-(Naphthalen-1-yl)ethanol Basic information |
| Product Name: | (R)-1-(Naphthalen-1-yl)ethanol | | Synonyms: | (r)-(+)-α-methyl-1-naphthalenemethanol;R-(-)-1-(1-Napthalenyl)ethanol;R-(-)-1-(1-naphthalenyl)ethanol;(R)-(+)-1-(1-NAPHTHYL)ETHANOL;(R)-(+)-ALPHA-METHYL-1-NAPHTHALENEMETHANOL;(1R)-1-(1-naphthyl)ethan;(1R)-1-(1-naphthyl)ethanol;1-Naphthalenemethanol, α-methyl-, (αR)- | | CAS: | 42177-25-3 | | MF: | C12H12O | | MW: | 172.22 | | EINECS: | | | Product Categories: | | | Mol File: | 42177-25-3.mol |  |
| | (R)-1-(Naphthalen-1-yl)ethanol Chemical Properties |
| Melting point | 47-49 °C(lit.) | | alpha | 78 º (C=1 IN MEOH) | | Boiling point | 316.0±11.0 °C(Predicted) | | density | 1.113±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.29±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C12H12O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9,13H,1H3/t9-/s3 | | InChIKey | CDRQOYRPWJULJN-DJEYLCQNNA-N | | SMILES | C12C=CC=CC=1C=CC=C2[C@H](O)C |&1:10,r| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29062990 |
| | (R)-1-(Naphthalen-1-yl)ethanol Usage And Synthesis |
| Chemical Properties | White solid | | Uses | (R)-1-(Naphthalen-1-yl)ethanol is a coupling reagent used in the synthesis of ferrocene aminophosphoxazoline ligands. | | Purification Methods | Purify the alcohol by recrystallisation from Et2O/pet ether, Et2O, hexane [Balfe et al. J Chem Soc 797 1946, IR, NMR: Theisen & Heathcock J Org Chem 53 2374 1988, see also Fredga et al. Acta Chem Scand 11 1609 1957]. The RS-alcohol [57605-95-5] has m 63-65o, 65-66o from hexane. [Beilstein 6 III 3034, 6 IV 4346.] |
| | (R)-1-(Naphthalen-1-yl)ethanol Preparation Products And Raw materials |
|