| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:9-cis-Retinal
CAS:514-85-2
Package:100Mg,10Mg
|
- 9-cis-Retinal
-
- $89.00 / 1mg
-
2026-03-13
- CAS:514-85-2
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 9-CIS-RETINAL Basic information |
| Product Name: | 9-CIS-RETINAL | | Synonyms: | 6-CIS-VITAMIN A ALDEHYDE;9-CIS-RETINAL;(2E,4E,6Z,8E)-3,7-Dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenal;(9Z)-Retinal;C031390;9-cis-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraen;9-cis-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenal;9-cis-Retinaldehyde | | CAS: | 514-85-2 | | MF: | C20H28O | | MW: | 284.44 | | EINECS: | 208-188-8 | | Product Categories: | Retinoids;Intermediates & Fine Chemicals;Pharmaceuticals;Aldehydes;Biochemicals and Reagents;Building Blocks;C13-C60;Carbonyl Compounds;Chemical Synthesis;Isoprenoids;Lipids;Nutrition Research;Organic Building Blocks;Prenols;Vitamin A;Vitamins | | Mol File: | 514-85-2.mol |  |
| | 9-CIS-RETINAL Chemical Properties |
| Melting point | 56-58 °C(lit.) | | Boiling point | 366.92°C (rough estimate) | | density | 1.0083 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | −20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Yellow to Orange | | Stability: | Light Sensitive, Temperature Sensitive | | InChI | 1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8-,17-13+ | | InChIKey | NCYCYZXNIZJOKI-MKOSUFFBSA-N | | SMILES | CC(=C\C=O)/C=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C | | EPA Substance Registry System | Retinal, 9-cis- (514-85-2) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-38 | | Safety Statements | 22-36/37 | | WGK Germany | 3 | | RTECS | VH6406500 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Skin Irrit. 2 |
| | 9-CIS-RETINAL Usage And Synthesis |
| Chemical Properties | Pale-Yellow Solid | | Uses | 9-cis-Retinal is an isomer of all-trans-Retinal (R240000). | | Definition | ChEBI: A retinal in which the double bond at position 9 has cis configuration, whilst the remaining acyclic double bonds have trans configuration. | | Biological Activity | Retinal, retinol and retinoic acid are the aldehyde, alcohol and acid forms of vitamin A. The retinoids exist as many geometric isomers due to the unsaturated bonds in the aliphatic chain.
9-cis retinal is a natural ligand (chromophore) of the vertebrate rod visual pigment. 9-cis retinal is used in studies on the mechanisms of visual function. | | Safety Profile | Experimental
reproductive effects.When heated to
decomposition it emits acrid smoke and
irritating fumes. |
| | 9-CIS-RETINAL Preparation Products And Raw materials |
| Raw materials | magnesium,ethynoxyethane,bromide, Fandachem-->Retinal, (9-cis,13-cis)--->4,4-Diethoxy-2-methylbut-1-ene-->Retinyl acetate-->9-CIS-RETINOIC ACID METHYL ESTER-->(2E,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraen-1-ol-->11-cis Retinal-->13-CIS-RETINAL-->Vitamin A |
|