- D-Galacturonic acid
-
- $1.00 / 1kg
-
2019-07-06
- CAS:25990-10-7
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 1000kg
|
| | POLYGALACTURONIC ACID Basic information |
| | POLYGALACTURONIC ACID Chemical Properties |
| Melting point | 60～61℃ | | storage temp. | Refrigerator | | solubility | aqueous NaOH: 1%, clear to hazy | | form | Solid | | color | Pale Beige | | Optical Rotation | +280 | | biological source | synthetic | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | InChI | 1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6-/m0/s1 | | InChIKey | AEMOLEFTQBMNLQ-BKBMJHBISA-N | | SMILES | O1[C@@H]([C@@H]([C@H]([C@H]([C@H]1C(=O)O)O)O)O)O | | EPA Substance Registry System | Galacturonic acid, homopolymer (25990-10-7) |
| WGK Germany | 3 | | F | 3 | | TSCA | TSCA listed | | HS Code | 1302201015 | | Storage Class | 11 - Combustible Solids |
| | POLYGALACTURONIC ACID Usage And Synthesis |
| Uses | Polygalacturonic Acid is found in ripe fruits and some vegetables and is a degradation product of pectin in plants. | | Uses | Polygalacturonic acid may be used to identify, differentiate and characterize plant cell wall degrading polygalacturonase(s) from fungi. | | Definition | ChEBI: D-galactopyranuronic acid is the pyranose form of D-galacturonic acid It is a conjugate acid of a D-galactopyranuronate. | | General Description | Polygalacturonic acid is composed of galacturonic acid unit arranged as a long polymer chain. Methyl esters of polygalacturonic acid forms pectin. | | Biochem/physiol Actions | In land plants, polygalacturonic acids are major components of cell wall polysaccharides (pectins). Bound polygalacturonase-inhibiting peptides (PGIP) protect pectin from degradation by fungal polygalacturonases. |
| | POLYGALACTURONIC ACID Preparation Products And Raw materials |
|