| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | tert-butyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate Basic information |
| Product Name: | tert-butyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate | | Synonyms: | tert-butyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate;(3S,4R)-4-(Boc-amino)-3-fluoropiperidine;tert-Butyl ((3S,4R)-3-fluoropiperidin-4-yl)carbamate;Carbamic acid, N-[(3S,4R)-3-fluoro-4-piperidinyl]-, 1,1-dimethylethyl ester;(3S,4R)-N-Boc-4-amino-3-fluoropiperidine | | CAS: | 1434126-99-4 | | MF: | C10H19FN2O2 | | MW: | 218.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1434126-99-4.mol | ![tert-butyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate Structure](CAS/GIF/1434126-99-4.gif) |
| | tert-butyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate Chemical Properties |
| Boiling point | 313.3±42.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 11.24±0.40(Predicted) | | Appearance | white solid | | InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-8-4-5-12-6-7(8)11/h7-8,12H,4-6H2,1-3H3,(H,13,14)/t7-,8+/m0/s1 | | InChIKey | MPIIBGAKGQZLDK-JGVFFNPUSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCNC[C@@H]1F |
| | tert-butyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate Usage And Synthesis |
| | tert-butyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate Preparation Products And Raw materials |
|