Cadmium acetate dihydrate manufacturers
|
| | Cadmium acetate dihydrate Basic information |
| | Cadmium acetate dihydrate Chemical Properties |
| Melting point | 254°C | | density | 2,01 g/cm3 | | bulk density | 950kg/m3 | | storage temp. | Store at +5°C to +30°C. | | solubility | very soluble in H2O; soluble in ethanol | | form | Powder | | color | White | | Specific Gravity | 2.341 | | Odor | Slight acetic acid odor | | PH | 7 (50g/l, H2O, 20℃) | | PH Range | 7.1 | | Water Solubility | Soluble | | Sensitive | Hygroscopic | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Merck | 14,1614 | | BRN | 3730567 | | Exposure limits | ACGIH: TWA 0.01 mg/m3; TWA 0.002 mg/m3
NIOSH: IDLH 9 mg/m3 | | Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. | | InChI | 1S/2C2H4O2.Cd.2H2O/c2*1-2(3)4;;;/h2*1H3,(H,3,4);;2*1H2/q;;+2;;/p-2 | | InChIKey | AUIZLSZEDUYGDE-UHFFFAOYSA-L | | SMILES | [H]O[H].[H]O[H].CC(=O)O[Cd]OC(C)=O | | CAS DataBase Reference | 5743-04-4(CAS DataBase Reference) |
| Hazard Codes | Xn,N,T | | Risk Statements | 20/21/22-50/53-45-50 | | Safety Statements | 60-61-53-45 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | RTECS | AF7505000 | | TSCA | No | | HS Code | 2915 29 00 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B
Muta. 1B
STOT RE 1 Oral | | Toxicity | LD50 orally in Rabbit: 333 mg/kg |
| | Cadmium acetate dihydrate Usage And Synthesis |
| Chemical Properties | White Crystalline Powder | | Uses | Cadmium acetate dihydrate is in theporcelain productionfor the productionof iridescentused effects.Moreover, it is in theanalytical chemistry,a reagent for the detection ofsulfur,seleniumand tellurium. It is also used as chemical and pharmaceutical intermediate. | | reaction suitability | reagent type: catalyst
core: cadmium | | Safety Profile | Confirmed human
carcinogen. Mutation data reported. When
heated to decomposition it emits toxic
fumes of Cd. | | Purification Methods | Recrystallise it twice from anhydrous acetic acid and dry it under vacuum for 24hours at 100o. [Beilstein 2 IV 114.] |
| | Cadmium acetate dihydrate Preparation Products And Raw materials |
|