| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd. Gold
|
| Tel: |
400-8210725 400821072 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:2-(1-Cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:1867923-49-6
Purity:95%
|
| Company Name: |
Suzhou Crst Pharmatech Co., Ltd.
|
| Tel: |
0512-62910395 17751098781 |
| Email: |
sales@crstpharma.com |
| Products Intro: |
Product Name:2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:1867923-49-6
Purity:98+ Package:100克，1KG 10KG 25KG
|
| Company Name: |
Jiaxing Deyi Chemical Co., Ltd.
|
| Tel: |
86-0573-85866609 18367600069 |
| Email: |
945717149@qq.com |
| Products Intro: |
Product Name:2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:1867923-49-6
Purity:98% Package:1g;5g;25g;50;100;500;1kg
|
|
| | 2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | 2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-(1-cyclopropylethenyl)-4,4,5,5-tetramethyl-;1-Cyclopropylvinylboronic Acid Pinacol Ester;2-(1-Cyclopropylethenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 1867923-49-6 | | MF: | C11H19BO2 | | MW: | 194.08 | | EINECS: | | | Product Categories: | | | Mol File: | 1867923-49-6.mol |  |
| | 2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 203.2±23.0 °C(Predicted) | | density | 0.95±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H19BO2/c1-8(9-6-7-9)12-13-10(2,3)11(4,5)14-12/h9H,1,6-7H2,2-5H3 | | InChIKey | DOGJSLVOGBGMJP-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C(C1CC1)=C |
| | 2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| | 2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|