3-phenanthreneboronic acid manufacturers
- 3- phenanthreneboronic acid
-
- $200.00 / 1KG
-
2025-09-25
- CAS:1188094-46-3
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-phenanthreneboronic acid Basic information |
| Product Name: | 3-phenanthreneboronic acid | | Synonyms: | 3-phenanthreneboronic acid;3-phenanthrenylboronic acid;phenanthren-3-ylboronicacid;Boronic acid, B-3-phenanthrenyl-;B-3-Phenanthrenylboronic acid;3-Phenanthrenylboronic 3-Phenanthrenylboronic acid | | CAS: | 1188094-46-3 | | MF: | C14H11BO2 | | MW: | 222.05 | | EINECS: | | | Product Categories: | | | Mol File: | 1188094-46-3.mol |  |
| | 3-phenanthreneboronic acid Chemical Properties |
| Boiling point | 479.5±28.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature, keep dry and cool | | pka | 8.53±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H11BO2/c16-15(17)12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,16-17H | | InChIKey | UPYVSYVLGOADDG-UHFFFAOYSA-N | | SMILES | B(C1C=C2C(=CC=1)C=CC1C2=CC=CC=1)(O)O |
| | 3-phenanthreneboronic acid Usage And Synthesis |
| Uses | 3-Phenanthreneboronic acid is mainly used as a reagent in palladium-catalyzed coupling reactions (such as the Suzuki-Miyaura coupling reaction) to construct complex phenanthrene derivatives and polycyclic aromatic hydrocarbons (PAHs). |
| | 3-phenanthreneboronic acid Preparation Products And Raw materials |
|