|
|
| | 5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE Basic information |
| Product Name: | 5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE | | Synonyms: | RARECHEM AS SA 0060;tetra-(4-aminophenyl)porphyrin;4,4',4'',4'''-(21H,23H-Porphyrin-5,10,15,20-tetryl)tetraaniline;4,4',4'',4'''-(21H,23H-Porphyrin-5,10,15,20-tetryl)tetrakis(benzenamine);4,4',4'',4'''-(21H,23H-Porphyrin-5,10,15,20-tetryl)tetrakisbenzenamine;meso-Tetra(p-aminophenyl)porphyrin;5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE 95+%;5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE | | CAS: | 22112-84-1 | | MF: | C44H34N8 | | MW: | 674.79 | | EINECS: | | | Product Categories: | Biochemistry;Highly Purified Reagents;Other Categories;Porphyrins;Refined Products by Sublimation | | Mol File: | 22112-84-1.mol |  |
| | 5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE Chemical Properties |
| density | 1.350 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to crystal | | color | Dark red to Dark purple to Dark blue | | InChIKey | REPFNYFEIOZRLM-LWQDQPMZSA-N | | SMILES | C1(C2=CC=C(N)C=C2)=C2N=C(C(C3=CC=C(N)C=C3)=C3NC(=C(C4=CC=C(N)C=C4)C4=NC(=C(C5=CC=C(N)C=C5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:20,t:8,23,35| |
| | 5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE Usage And Synthesis |
| Uses | 5,10,15,20-Tetrakis(4-aminophenyl)porphyrin (CAS# 22112-84-1) is a porphyrin derivative used in the preparation of metal complexes, such as those of Fe(III) for the use of catalyzing the electrochemical oxygen reduction reaction. |
| | 5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE Preparation Products And Raw materials |
|