| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
2-bromo-5-fluoro-1,3-thiazole manufacturers
|
| | 2-bromo-5-fluoro-1,3-thiazole Basic information |
| | 2-bromo-5-fluoro-1,3-thiazole Chemical Properties |
| Boiling point | 176.9±13.0 °C(Predicted) | | density | 1.967±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | pka | -0.62±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C3HBrFNS/c4-3-6-1-2(5)7-3/h1H | | InChIKey | VXNUGJCISAFNPM-UHFFFAOYSA-N | | SMILES | S1C(F)=CN=C1Br |
| | 2-bromo-5-fluoro-1,3-thiazole Usage And Synthesis |
| Uses | 2-Bromo-5-fluoro-1,3-thiazole is a useful research chemical used in the preparation of pyrazolopyridinones and pyrazolopyrimidinones as TYK2 inhibitors. |
| | 2-bromo-5-fluoro-1,3-thiazole Preparation Products And Raw materials |
|