|
|
| | methyl 3-bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate Basic information |
| Product Name: | methyl 3-bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate | | Synonyms: | methyl 3-bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate;1H-1,2,4-Triazole-5-carboxylic acid, 3-bromo-1-methyl-, methyl ester;ethyl 3-bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate | | CAS: | 1559067-56-9 | | MF: | C5H6BrN3O2 | | MW: | 220.02 | | EINECS: | | | Product Categories: | | | Mol File: | 1559067-56-9.mol |  |
| | methyl 3-bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate Chemical Properties |
| Boiling point | 329.4±25.0 °C(Predicted) | | density | 1.84±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | pka | -1.13±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H6BrN3O2/c1-9-3(4(10)11-2)7-5(6)8-9/h1-2H3 | | InChIKey | NCYGUUBYLZQAOM-UHFFFAOYSA-N | | SMILES | N1(C)C(C(OC)=O)=NC(Br)=N1 |
| | methyl 3-bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate Usage And Synthesis |
| Uses | Methyl 3-Bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate is a useful reagent for preparing 3-Bromo-5-(methoxymethyl)-1-methyl-1H-1,2,4-triazole (B155000(M)), which is used to prepare substituted indoles as Mcl-1 inhibitors. |
| | methyl 3-bromo-1-methyl-1H-1,2,4-triazole-5-carboxylate Preparation Products And Raw materials |
|