| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
2-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine manufacturers
|
| | 2-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine Basic information |
| Product Name: | 2-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine | | Synonyms: | 2-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine;2-(3-(But-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine 95%;3-(3-Butyn-1-yl)-3H-diazirine-3-ethanamine;3-(but-3-ynyl)-3-(2-aminoethyl)-3H-diazirine;2-(3-(But-3-yn-1-yl)-3H-diazirin-3-yl)ethanamine;3H-Diazirine-3-ethanamine, 3-(3-butyn-1-yl)-;Alkyne-Diazirine-Amine;Pr-DiAz-NH2 | | CAS: | 1450752-97-2 | | MF: | C7H11N3 | | MW: | 137.18 | | EINECS: | | | Product Categories: | SiChem | | Mol File: | 1450752-97-2.mol |  |
| | 2-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine Chemical Properties |
| Boiling point | 192.5±36.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | liquid | | pka | 9.77±0.10(Predicted) | | color | Colourless to Yellow | | InChI | InChI=1S/C7H11N3/c1-2-3-4-7(5-6-8)9-10-7/h1H,3-6,8H2 | | InChIKey | FMCIBERQJQEYIZ-UHFFFAOYSA-N | | SMILES | N1C(CCC#C)(CCN)N=1 |
| WGK Germany | WGK 3 | | Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | | Hazard Classifications | Self-react. C |
| | 2-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine Usage And Synthesis |
| Uses | 2-(3-(But-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine is used for chemical probe synthesis, this trifunctional building block contains a light-activated diazirine, alkyne tag, and amine synthetic handle. When appended to a ligand or pharmacophore through its amine linker, this building block allows for UV light-induced covalent modification of a biological target with potential for downstream applications via the alkyne tag. Use alone or in parallel with other multi-functional building blocks to discover the optimal probe for your chemical biology experiments. |
| | 2-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)ethan-1-amine Preparation Products And Raw materials |
|