Tos-PEG5 t-butyl ester manufacturers
- Tos-PEG5-COOtBu
-
- $0.00 / 5g
-
2025-06-07
- CAS:581065-94-3
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | Tos-PEG5 t-butyl ester Basic information |
| Product Name: | Tos-PEG5 t-butyl ester | | Synonyms: | tert-butyl 3-[2-(2-{2-[2-(toluene-4-sulfonyloxy)-ethoxy]ethoxy}ethoxy)ethoxy]propionate;CAS_581065-94-3;Tos-PEG5 t-butyl ester;tert-Butyl 1-(Tosyloxy)-3,6,9,12-tetraoxapentadecan-15-oate;Tos-PEG5-Boc;Tos-PEG5-COOtBu;4,7,10,13-Tetraoxapentadecanoic acid, 15-[[(4-methylphenyl)sulfonyl]oxy]-, 1,1-dimethylethyl ester;Tos-PEG4-COOtBu | | CAS: | 581065-94-3 | | MF: | C22H36O9S | | MW: | 476.58 | | EINECS: | | | Product Categories: | | | Mol File: | 581065-94-3.mol |  |
| | Tos-PEG5 t-butyl ester Chemical Properties |
| Boiling point | 560.5±50.0 °C(Predicted) | | density | 1.151±0.06 g/cm3(Predicted) | | refractive index | 1.49 | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C22H36O9S/c1-19-5-7-20(8-6-19)32(24,25)30-18-17-29-16-15-28-14-13-27-12-11-26-10-9-21(23)31-22(2,3)4/h5-8H,9-18H2,1-4H3 | | InChIKey | GGGJGMGLGUHUMW-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOS(C1=CC=C(C)C=C1)(=O)=O |
| | Tos-PEG5 t-butyl ester Usage And Synthesis |
| Description | Tos-PEG5-t-butyl ester is a PEG linker containing a t-butyl ester and a tosyl group. The hydrophilic PEG spacer increases solubility in aqueous media. The t-butyl protected carboxyl group can be deprotected under acidic conditions. The tosyl group is a very good leaving group for nucleophilic substitution reactions. | | Uses | This compound is used in preparation of taxanes. Taxanes have improved its toxicity and solubility in aqueous solution compared to paciitaxel. | | IC 50 | PEGs; Alkyl/ether |
| | Tos-PEG5 t-butyl ester Preparation Products And Raw materials |
|