| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 4,5-Dibromo-3-chlorothiophene-2-carboxylic acid Basic information |
| | 4,5-Dibromo-3-chlorothiophene-2-carboxylic acid Chemical Properties |
| Boiling point | 386.1±42.0 °C(Predicted) | | density | 2.359±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.89±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C5HBr2ClO2S/c6-1-2(8)3(5(9)10)11-4(1)7/h(H,9,10) | | InChIKey | XOUIIPXNMPQGGQ-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC(Br)=C(Br)C=1Cl |
| | 4,5-Dibromo-3-chlorothiophene-2-carboxylic acid Usage And Synthesis |
| | 4,5-Dibromo-3-chlorothiophene-2-carboxylic acid Preparation Products And Raw materials |
|