| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | Sodium pyridine-2-sulfinate Basic information |
| Product Name: | Sodium pyridine-2-sulfinate | | Synonyms: | Sodium pyridine-2-sulfinate;Sodium pyridine-2-sulfinate >=95%;140723;2-pyridinesulfinic acid sodium salt;Pyridine-2-sulfinic Acid Sodium Salt;Sodium pyridine-2-sulfanate | | CAS: | 24367-66-6 | | MF: | C5H6NNaO2S | | MW: | 167.16 | | EINECS: | | | Product Categories: | | | Mol File: | 24367-66-6.mol |  |
| | Sodium pyridine-2-sulfinate Chemical Properties |
| Melting point | 292°C | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Soluble in water | | form | powder or crystals | | color | White to Light yellow | | InChI | InChI=1S/C5H5NO2S.Na.H/c7-9(8)5-3-1-2-4-6-5;;/h1-4H,(H,7,8);; | | InChIKey | BXNGGEMDLGOFRZ-UHFFFAOYSA-N | | SMILES | S(C1N=CC=CC=1)(O)=O.[NaH] |
| WGK Germany | WGK 3 | | HS Code | 2933.39.6190 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Sodium pyridine-2-sulfinate Usage And Synthesis |
| Uses | This 2-pyridylsulfinate enables Suzuki-Miyaura cross coupling with aryl halides to access diverse pyridine derivatives as reported by the laboratory of Michael Willis.. No longer impeded by unstable 2-pyridyl boronates, the sulfinate alternatives provide Pd-catalyzed coupling routes to therapeutically valuable pyridine rings. | | reaction suitability | reaction type: C-C Bond Formation |
| | Sodium pyridine-2-sulfinate Preparation Products And Raw materials |
|