methyl 2-(4-vinylphenyl)acetate manufacturers
|
| | methyl 2-(4-vinylphenyl)acetate Basic information |
| Product Name: | methyl 2-(4-vinylphenyl)acetate | | Synonyms: | methyl 2-(4-vinylphenyl)acetate;Benzeneacetic acid, 4-ethenyl-, methyl ester;2-(4-vinylphenyl) acetate methyl ester;methyl 2-(4-ethenylphenyl)acetate;methyl (4-vinylphenyl)acetate | | CAS: | 62667-42-9 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | | | Product Categories: | | | Mol File: | 62667-42-9.mol |  |
| | methyl 2-(4-vinylphenyl)acetate Chemical Properties |
| Boiling point | 107 °C(Press: 2 Torr) | | density | 1.047±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C11H12O2/c1-3-9-4-6-10(7-5-9)8-11(12)13-2/h3-7H,1,8H2,2H3 | | InChIKey | KDHZKCPMBLLEQE-UHFFFAOYSA-N | | SMILES | C1(CC(OC)=O)=CC=C(C=C)C=C1 |
| | methyl 2-(4-vinylphenyl)acetate Usage And Synthesis |
| | methyl 2-(4-vinylphenyl)acetate Preparation Products And Raw materials |
|