3-Iodobenzylamine manufacturers
- 3-Iodobenzylamine
-
- $9.80 / 1KG
-
2020-01-05
- CAS: 696-40-2
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg -1000kg
|
| | 3-Iodobenzylamine Basic information |
| Product Name: | 3-Iodobenzylamine | | Synonyms: | AURORA KA-7711;3-IODOBENZYLAE;3-Iodobenzenemethanamine;3-IODOBENZYLAMINE;RARECHEM AL BW 0705;3-Iodobenzylamine,97%;3-IodobenzylaMine, 97% 1GR;(3-iodophenyl)MethanaMine | | CAS: | 696-40-2 | | MF: | C7H8IN | | MW: | 233.05 | | EINECS: | 625-616-2 | | Product Categories: | Amines;C7;Nitrogen Compounds | | Mol File: | 696-40-2.mol |  |
| | 3-Iodobenzylamine Chemical Properties |
| Melting point | 248-249 °C(Solv: N,N-dimethylformamide (68-12-2)) | | Boiling point | 132 °C/8 mmHg (lit.) | | density | 1.748 g/mL at 25 °C (lit.) | | refractive index | 1.638-1.64 | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.79±0.10(Predicted) | | form | Liquid | | color | Clear light yellow | | Water Solubility | Difficult to mix in water. | | Sensitive | Air & Light Sensitive | | BRN | 2689602 | | InChI | InChI=1S/C7H8IN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2 | | InChIKey | LQLOGZQVKUNBRX-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=CC(I)=C1 | | CAS DataBase Reference | 696-40-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-42/43-63 | | Safety Statements | 23-26-36/37/39 | | RIDADR | 2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29214990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Repr. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 3-Iodobenzylamine Usage And Synthesis |
| Chemical Properties | clear light yellow liquid | | Uses | It is a pharmaceutical intermediate. |
| | 3-Iodobenzylamine Preparation Products And Raw materials |
|