|
|
| | 2,4,6-Trichloro-benzaldehyde-oxime Basic information |
| Product Name: | 2,4,6-Trichloro-benzaldehyde-oxime | | Synonyms: | 2,4,6-Trichloro-benzaldehyde-oxime;(E)-N-[(2,4,6-trichlorophenyl)methylidene]hydroxylamine;Benzaldehyde, 2,4,6-trichloro-, oxime | | CAS: | 22241-21-0 | | MF: | C7H4Cl3NO | | MW: | 224.47 | | EINECS: | | | Product Categories: | | | Mol File: | 22241-21-0.mol |  |
| | 2,4,6-Trichloro-benzaldehyde-oxime Chemical Properties |
| Boiling point | 305.928±42.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.531±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 9.717±0.10(predicted) | | InChI | InChI=1S/C7H4Cl3NO/c8-4-1-6(9)5(3-11-12)7(10)2-4/h1-3,12H/b11-3+ | | InChIKey | FCBBNUOWHZWGFM-QDEBKDIKSA-N | | SMILES | C(=N/O)\C1=C(Cl)C=C(Cl)C=C1Cl |
| | 2,4,6-Trichloro-benzaldehyde-oxime Usage And Synthesis |
| | 2,4,6-Trichloro-benzaldehyde-oxime Preparation Products And Raw materials |
|