|
|
| | 3,4-Diaminobenzenesulfonic acid Basic information |
| | 3,4-Diaminobenzenesulfonic acid Chemical Properties |
| Melting point | -12 °C | | Boiling point | 178-179 °C3 mm Hg(lit.) | | density | 0.936 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.441(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | hexane, toluene, ethanol and acetone: soluble | | pka | -0.52±0.50(Predicted) | | form | Solid | | color | Dark Brown | | Dielectric constant | 4.5（30℃） | | InChI | InChI=1S/C6H8N2O3S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,7-8H2,(H,9,10,11) | | InChIKey | FKSRSWQTEJTBMI-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(N)C(N)=C1 | | CAS DataBase Reference | 7474-78-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 3,4-diamino- (7474-78-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | RTECS | VS1150000 | | TSCA | TSCA listed |
| | 3,4-Diaminobenzenesulfonic acid Usage And Synthesis |
| Uses | 3,4-Diaminobenzenesulfonic Acid is a useful organic synthetic reagent and a sulfonate-aminium zwitterion. | | Synthesis | The general procedure for the synthesis of 3,4-diaminobenzenesulfonic acid from o-phenylenediamine was as follows: first, the sulfonation mixture was prepared by dissolving 160 g (1.48 mol) of 1,2-diaminobenzene in 800 g (435 mL; 8.16 mol) of 95-97% sulfuric acid. Subsequently, the sulfonated mixture was divided into four portions and pumped into a continuous flow microreactor for the reaction. The microreactor consisted of a sequentially connected inlet module, five residence modules and an outlet module, each of which was maintained at a constant reaction temperature. Upon completion of the reaction, the sulfonation mixture was rapidly cooled with water at the reactor outlet to allow the sulfonation reaction products to precipitate in an ice-water bath. After filtration, the resulting white product was characterized by nuclear magnetic resonance (NMR). Based on 1H-NMR spectroscopy (400 MHz, DMSO-d6) analysis, no isomers were detected in all the products isolated in the experiments, confirming the formation of 3,4-diaminobenzenesulfonic acid and the absence of impurities. The yields of the products were influenced by the reaction temperature and residence time: 80% at 160 °C reaction temperature for 25 min, 89%, 90% and 100% at 180 °C reaction temperature for 5, 10 and 25 min, respectively. | | References | [1] Patent: WO2012/74822, 2012, A1. Location in patent: Page/Page column 19-20
[2] Patent: EP2457886, 2012, A1. Location in patent: Page/Page column 9
[3] Patent: EP1400507, 2004, A1. Location in patent: Page 4; 5
[4] Tetrahedron, 2008, vol. 64, # 22, p. 5410 - 5415
[5] Patent: US2012/225863, 2012, A1. Location in patent: Page/Page column 40 |
| | 3,4-Diaminobenzenesulfonic acid Preparation Products And Raw materials |
|