| Company Name: |
Merck Millipore
|
| Tel: |
1-400-889-1988 400-889-1988 |
| Email: |
bioscience@merckgroup.com |
| Products Intro: |
Product Name:Eg5 Inhibitor IV, VS-83 - CAS 909250-29-9 - Calbiochem
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Eg5 Inhibitor IV, VS-83
CAS:909250-29-9
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:Eg5 Inhibitor IV, VS-83
CAS:909250-29-9
|
|
| | Eg5 Inhibitor IV, VS-83 Basic information |
| Product Name: | Eg5 Inhibitor IV, VS-83 | | Synonyms: | Eg5 Inhibitor IV, VS-83;Eg5 Inhibitor IV, VS-83 - CAS 909250-29-9 - Calbiochem;2(1H)-Quinazolinethione, 5-fluoro-3,4-dihydro-4-(3-hydroxyphenyl)- | | CAS: | 909250-29-9 | | MF: | C14H11FN2OS | | MW: | 274.31 | | EINECS: | | | Product Categories: | | | Mol File: | 909250-29-9.mol |  |
| | Eg5 Inhibitor IV, VS-83 Chemical Properties |
| Melting point | 215-217 °C | | Boiling point | 379.7±52.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | -20C | | solubility | ethanol: 5mg/mL
DMSO: 50mg/mL | | form | White solid | | pka | 9.60±0.10(Predicted) | | color | white | | InChI | 1S/C14H11FN2OS/c15-10-5-2-6-11-12(10)13(17-14(19)16-11)8-3-1-4-9(18)7-8/h1-7,13,18H,(H2,16,17,19) | | InChIKey | MAEYCDNDKNPNQJ-UHFFFAOYSA-N | | SMILES | Fc1c2c(ccc1)NC(=S)NC2c3cc(ccc3)O |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | Eg5 Inhibitor IV, VS-83 Usage And Synthesis |
| Uses | Eg5 Inhibitor IV, VS-83 is an inhibitor of mitotic kinesin Eg5-ATPase activity. |
| | Eg5 Inhibitor IV, VS-83 Preparation Products And Raw materials |
|