| Company Name: |
PharmaBlock Sciences (Nanjing), Inc. Gold
|
| Tel: |
4000255188 |
| Email: |
sales@pharmablock.com |
| Products Intro: |
Product Name:ethyl 2,4,5-trifluoro-3-hydroxy-benzoate
CAS:128426-84-6
Purity:98% Package:1KG;10KG;100KG
|
|
| | 2,4,5-Trifluoro-3-hydroxybenzoic acid ethyl ester Basic information |
| Product Name: | 2,4,5-Trifluoro-3-hydroxybenzoic acid ethyl ester | | Synonyms: | 2,4,5-Trifluoro-3-hydroxybenzoic acid ethyl ester;CADR-003;Ethyl 2,4,5-trifluoro-3-hydroxybenzoate;Benzoic acid, 2,4,5-trifluoro-3-hydroxy-, ethyl ester;ethyl 2,4,5-trifluoro-3-hydroxy-benzoate - [E82200] | | CAS: | 128426-84-6 | | MF: | C9H7F3O3 | | MW: | 220.15 | | EINECS: | | | Product Categories: | | | Mol File: | 128426-84-6.mol |  |
| | 2,4,5-Trifluoro-3-hydroxybenzoic acid ethyl ester Chemical Properties |
| Boiling point | 291.0±40.0 °C(Predicted) | | density | 1.421±0.06 g/cm3(Predicted) | | pka | 5.68±0.20(Predicted) | | InChI | InChI=1S/C9H7F3O3/c1-2-15-9(14)4-3-5(10)7(12)8(13)6(4)11/h3,13H,2H2,1H3 | | InChIKey | JYEZWXDCOOQHTP-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C1=CC(F)=C(F)C(O)=C1F |
| | 2,4,5-Trifluoro-3-hydroxybenzoic acid ethyl ester Usage And Synthesis |
| | 2,4,5-Trifluoro-3-hydroxybenzoic acid ethyl ester Preparation Products And Raw materials |
|