|
|
| | 7-(Difluoromethyl)Quinoline Basic information |
| | 7-(Difluoromethyl)Quinoline Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Light yellow to yellow Oil | | InChI | InChI=1S/C10H7F2N/c11-10(12)8-4-3-7-2-1-5-13-9(7)6-8/h1-6,10H | | InChIKey | CPYCSVBOWJMMBM-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(C(F)F)C=2)C=CC=1 |
| | 7-(Difluoromethyl)Quinoline Usage And Synthesis |
| Uses | 7-(Difluoromethyl)quinoline is an intermediate in the synthesis of GNE-781 (D447825), a derivative of a highly advanced, potent and selective bromodomain inhibitor of cyclic adenosine monophosphate response element binding protein (CBP). Inhibition of the bromodomain of the transcriptional regulator CBP/P300 is an especially interesting new therapeutic approach in oncology. | | Application | 7-(Difluoromethyl)Quinoline can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. |
| | 7-(Difluoromethyl)Quinoline Preparation Products And Raw materials |
|