| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
NSC 756093 manufacturers
- NSC756093
-
- $34.00
-
2026-07-16
- CAS:1629908-92-4
- Purity: 99.92%
- Supply Ability: 10g
|
| | NSC 756093 Basic information |
| Product Name: | NSC 756093 | | Synonyms: | NSC 756093;4-(2-hydroxyethyl)-6-methoxy-9-phenyl-3,9-dihydrofuro[3,4-b]quinolin-1-one;NSC756093 >=98% (HPLC);paclitaxel resistant,anticancer,NSC756093,ovarian cancer,NCI-60 cell,inhibit,SKOV3 cells,Inhibitor;Furo[3,4-b]quinolin-1(3H)-one, 4,9-dihydro-4-(2-hydroxyethyl)-6-methoxy-9-phenyl-;4-(2-Hydroxyethyl)-6-methoxy-9-phenyl-4,9-dihydrofuro[3,4-b]quinolin-1(3H)-one;4,9-Dihydro-4-(2-hydroxyethyl)-6-methoxy-9-phenylfuro[3,4-b]quinolin-1(3H)-one;NSC756093, 10 mM in DMSO | | CAS: | 1629908-92-4 | | MF: | C20H19NO4 | | MW: | 337.37 | | EINECS: | | | Product Categories: | | | Mol File: | 1629908-92-4.mol |  |
| | NSC 756093 Chemical Properties |
| Boiling point | 561.8±50.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble | | form | A solid | | pka | 14.56±0.10(Predicted) | | color | White to off-white | | InChI | 1S/C20H19NO4/c1-24-14-7-8-15-16(11-14)21(9-10-22)17-12-25-20(23)19(17)18(15)13-5-3-2-4-6-13/h2-8,11,18,22H,9-10,12H2,1H3 | | InChIKey | SMEJQLRLHKWIFV-UHFFFAOYSA-N | | SMILES | OCCN1C2=C(C(OC2)=O)C(C3=CC=CC=C3)C4=C1C=C(OC)C=C4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1 |
| | NSC 756093 Usage And Synthesis |
| Uses | NSC756093 is the first inhibitor of the GBP1 and PIM1 interaction. | | Biological Activity | NSC756093, a podophyllotoxin analog, is a potent and specific inhibitor of GBP1:PIM1 interaction th at inhibits proliferation of paclitaxel resistant cancer cells. Apparently, NSC756093 stabilizes a conformation of GBP1 not suitable for binding to PIM1. |
| | NSC 756093 Preparation Products And Raw materials |
|