| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | SnAP DA Reagent Basic information |
| Product Name: | SnAP DA Reagent | | Synonyms: | SnAP DA Reagent;tert-Butyl (3-aminopropyl)[(tributylstannyl)methyl]carbamate;Carbamic acid, N-(3-aminopropyl)-N-[(tributylstannyl)methyl]-, 1,1-dimethylethyl ester;tert-butyl N-(3-aminopropyl)-N-[(tributylstannyl)methyl]carbamate;N1-Boc-N1-[(tributylstannyl)methyl]propane-1,3-diamine;tert-Butyl (3-aminopropyl)[(tributylstannyl)methyl]carbamate - [B4491] | | CAS: | 1577233-73-8 | | MF: | C21H46N2O2Sn | | MW: | 477.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1577233-73-8.mol |  |
| | SnAP DA Reagent Chemical Properties |
| Boiling point | 472.3±55.0 °C(Predicted) | | storage temp. | -20°C | | form | liquid | | pka | 10.04±0.10(Predicted) | | InChI | 1S/C9H19N2O2.3C4H9.Sn/c1-9(2,3)13-8(12)11(4)7-5-6-10;3*1-3-4-2;/h4-7,10H2,1-3H3;3*1,3-4H2,2H3; | | InChIKey | IXXRAKGOXZKYBH-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CN(C(OC(C)(C)C)=O)CCCN)CCCC |
| RIDADR | UN 2788 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | SnAP DA Reagent Usage And Synthesis |
| Uses | SnAP Reagents provide a one-step route, in tandem with various aldehyde substrates, to saturated N-heterocycles. The synthesis of N-Heterocycles through SnAP Reagents require mild reaction conditions and aldehydes bearing aryl, heteroaryl, aliphatic, halogenated and glyoxylates are well tolerated. This product was introduced in collaboration with the Jeffrey Bode Research Group. |
| | SnAP DA Reagent Preparation Products And Raw materials |
|