3-(N-Morpholino)propanesulfonic acid hemisodium salt manufacturers
|
| | 3-(N-Morpholino)propanesulfonic acid hemisodium salt Basic information |
| Product Name: | 3-(N-Morpholino)propanesulfonic acid hemisodium salt | | Synonyms: | 3-N-MORPHOLINOPROPANESULFONIC ACID HEMISODIUM SALT;3-MORPHOLINOPROPANESULFONIC ACID HEMISODIUM SALT;4-Morpholinepropanesulfonic acid hemisodium salt;mops hemisodium in foil pouches,*tru-measure chem;MOPS, hemisodium salt 3-(N-Morpholino)propanesulfonic acid, hemisodium salt;MOPS HEMISODIUM IN FOIL POUCHES,*TRU-MEA SURE CHEMIC;MOPS HEMISODIUM;3-(N-MORPHOLINO)PROPANESULPHONIC ACID, HEMISODIUM SALT | | CAS: | 117961-20-3 | | MF: | C7H16NNaO4S | | MW: | 233.26 | | EINECS: | 601-500-7 | | Product Categories: | Buffer | | Mol File: | 117961-20-3.mol |  |
| | 3-(N-Morpholino)propanesulfonic acid hemisodium salt Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: 0.5 g/mL, clear, colorless | | form | powder or crystals | | PH | 6.5-7.5 (25°C) | | PH Range | 6.5 - 7.9 | | pka | 7.2(at 25℃) | | Water Solubility | water: 500mg/mL, clear, colorless to almost colorless | | InChI | 1S/2C7H15NO4S.Na/c2*9-13(10,11)7-1-2-8-3-5-12-6-4-8;/h2*1-7H2,(H,9,10,11);/q;;+1/p-1 | | InChIKey | OVCWZKQPQOVIDT-UHFFFAOYSA-M | | SMILES | [Na+].OS(=O)(=O)CCCN1CCOCC1.[O-]S(=O)(=O)CCCN2CCOCC2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 3-(N-Morpholino)propanesulfonic acid hemisodium salt Usage And Synthesis |
| Chemical Properties | White crystal | | Uses | MOPS hemisodium salt, 98% is a buffer commonly used in molecular biology and biochemical research, providing precise pH control in various experimental settings. |
| | 3-(N-Morpholino)propanesulfonic acid hemisodium salt Preparation Products And Raw materials |
|