|
|
| | vildagliptin Impurity E Basic information |
| Product Name: | vildagliptin Impurity E | | Synonyms: | Vildagliptin Impurity 3/Vildagliptin Mono Keto Impurity/Hexahydro-2-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)-1-imino- pyrrolo[1,2-a]pyraz;Vildagliptin Mono keto Impurity;Vildagliptin mono keto imp;Vildagliptin Imp.E HCl;Pyrrolo[1,2-a]pyrazin-4(1H)-one, hexahydro-2-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)-1-imino-;2-((1r,3s,5R,7S)-3-hydroxyadamantan-1-yl)-1-iminohexahydropyrrolo[1,2-a]pyrazin-4(1H)-one;Vildagliptin imine imp;Vogliptin impurity 2 | | CAS: | 1789703-37-2 | | MF: | C17H25N3O2 | | MW: | 303.4 | | EINECS: | | | Product Categories: | | | Mol File: | 1789703-37-2.mol |  |
| | vildagliptin Impurity E Chemical Properties |
| Boiling point | 479.4±55.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly), Dichloromethane | | pka | 15.21±0.40(Predicted) | | form | Solid | | color | Pale Yellow to Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C17H25N3O2/c18-15-13-2-1-3-19(13)14(21)9-20(15)16-5-11-4-12(6-16)8-17(22,7-11)10-16/h11-13,18,22H,1-10H2 | | InChIKey | ZZYCWDSBZNHPIN-UHFFFAOYSA-N | | SMILES | C12CCCN1C(=O)CN(C13CC4CC(CC(O)(C4)C1)C3)C2=N |
| | vildagliptin Impurity E Usage And Synthesis |
| Uses | Vildagliptin Cyclo Imidamide Hydrochloride is an impurity of vildagliptin (V305000). Glyptins are class of oral anti-hyperglycemic agents that inhibit dipeptidyl peptidase 4 (DPP-4), which can act as a serine exopeptidase. ASide from there use in type 2 diabetes, gliptins have positive cardiovascular and anti-inflammtatory effects. Antidiabetic. |
| | vildagliptin Impurity E Preparation Products And Raw materials |
|