Eribulin intermediate manufacturers
- Eribulin intermediate
-
- $0.00 / 1kg
-
2025-04-04
- CAS:157322-47-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | Eribulin intermediate Basic information |
| Product Name: | Eribulin intermediate | | Synonyms: | Eribulin mesylate intermediate3;Eribulin intermediate ERB;3-((2S,5S)-5-((3R,5R)-3-hydroxy-6-iodo-5-methylhept-6-enyl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate;[2S-[2alpha,5beta(3S*,5S*)]]-2,2-Dimethylpropanoic acid 3-[tetrahydro-5-(3-hydroxy-6-iodo-5-methyl-6-heptenyl)-4-methylene-2-furanyl]propyl ester;Eribulin Fragment B Alcohol;Eribulin Related Compound 1;3-((2S,5S)-5-((3R,5R)-3-hydroxy-6-iodo-5-methylhept-6-en-1-yl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate;Propanoic acid, 2,2-dimethyl-, 3-[tetrahydro-5-(3-hydroxy-6-iodo-5-methyl-6-heptenyl)-4-methylene-2-furanyl]propyl ester, [2S-[2α,5β(3S*,5S*)]]- (9CI) | | CAS: | 157322-47-9 | | MF: | C21H35IO4 | | MW: | 478.41 | | EINECS: | | | Product Categories: | Intermediates;157322-47-9 | | Mol File: | 157322-47-9.mol |  |
| | Eribulin intermediate Chemical Properties |
| Boiling point | 491.8±45.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C, stored under nitrogen | | pka | 14.89±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1/C21H35IO4/c1-14(16(3)22)12-17(23)9-10-19-15(2)13-18(26-19)8-7-11-25-20(24)21(4,5)6/h14,17-19,23H,2-3,7-13H2,1,4-6H3/t14-,17-,18+,19+/s3 | | InChIKey | BATPHVGPKRJKIK-DJOQLSLINA-N | | SMILES | C([C@H]1C(C[C@H](CCCOC(=O)C(C)(C)C)O1)=C)C[C@@H](O)C[C@@H](C)C(I)=C |&1:1,4,18,21,r| |
| | Eribulin intermediate Usage And Synthesis |
| Uses | [2S-[2α,5β(3S*,5S*)]]-2,2-Dimethyl-Propanoic Acid 3-[tetrahydro-5-(3-hydroxy-6-iodo-5-methyl-6-heptenyl)-4-methylene-2-furanyl]propyl Ester,can be used in the synthesis of norhalichondrin B. |
| | Eribulin intermediate Preparation Products And Raw materials |
|