| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) manufacturers
- fac-Ir(p-CF3ppy)3
-
-
2025-06-07
- CAS:500295-52-3
- Min. Order: 250mg
- Purity: >99.00%
- Supply Ability: 250mg
|
| | Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) Basic information |
| Product Name: | Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) | | Synonyms: | Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III);TRIS[(2-(2-PYRIDINYL-KN)-5-(TRIFLUOROMETHYL)PHENYL-KC]IRIDIUM(III),95%;Tris[(2-(2-pyridinyl-kN)-5-(trifluoromethyl)phenyl-kC]iridium(III), 95%;Tris[2-(2-pyridinyL;-κN)-5-(trifL;-κC]iridium(III);Ir(p-CF3-ppy)3 >=95%;fac-Tris[2-(4-trifluoromethylphenyl)pyridine]iridium(III) | | CAS: | 500295-52-3 | | MF: | C36H21F9IrN3 | | MW: | 858.79 | | EINECS: | | | Product Categories: | | | Mol File: | 500295-52-3.mol | ![Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) Structure](CAS/20210111/GIF/500295-52-3.gif) |
| | Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) Chemical Properties |
| Melting point | >300°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | yellow | | Sensitive | air sensitive | | InChI | 1S/3C12H7F3N.Ir/c3*13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11;/h3*1-4,6-8H; | | InChIKey | ZLVNAIXHGHEODI-UHFFFAOYSA-N | | SMILES | [Ir]741([NH]8=C(c9c7cc(cc9)C(F)(F)F)C=CC=C8)([NH]5=C(c6c4cc(cc6)C(F)(F)F)C=CC=C5)[NH]2=C(c3c1cc(cc3)C(F)(F)F)C=CC=C2 |
| Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids |
| | Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) Usage And Synthesis |
| Uses | This photocatalyst facilitates a variety of transformations using visible light, including the defluorination of arenes. | | reaction suitability | core: iridium reagent type: catalyst reaction type: Photocatalysis |
| | Tris[2-(2-pyridinyl-κN)-5-(trifluoromethyl)phenyl-κC]iridium(III) Preparation Products And Raw materials |
|